C11H7N5O8 — CID 15284854
(2,4,6-trinitrophenyl) 2-imidazol-1-ylacetate (PubChem CID 15284854) has the molecular formula C11H7N5O8 and a molecular weight of 337.20 g/mol. Its IUPAC name is (2,4,6-trinitrophenyl) 2-imidazol-1-ylacetate.
| Compound Name | (2,4,6-trinitrophenyl) 2-imidazol-1-ylacetate |
|---|---|
| PubChem CID | 15284854 |
| Molecular Formula | C11H7N5O8 |
| Molecular Weight | 337.20 g/mol |
| Exact Mass | 337.03 |
| IUPAC Name | (2,4,6-trinitrophenyl) 2-imidazol-1-ylacetate |
| SMILES | O=C(Cn1ccnc1)Oc1c([N+](=O)[O-])cc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H7N5O8/c17-10(5-13-2-1-12-6-13)24-11-8(15(20)21)3-7(14(18)19)4-9(11)16(22)23/h1-4,6H,5H2 |
| InChIKey | HQPJNHDOHIGSHO-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 173.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.20 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|