C27H32N4 — CID 152849898
15-tert-butyl-9-methyl-11-phenyl-9-propyl-1,11,13,16-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-2,4,6,12,14,16-hexaene (PubChem CID 152849898) has the molecular formula C27H32N4 and a molecular weight of 412.58 g/mol. Its IUPAC name is 15-tert-butyl-9-methyl-11-phenyl-9-propyl-1,11,13,16-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-2,4,6,12,14,16-hexaene.
| Compound Name | 15-tert-butyl-9-methyl-11-phenyl-9-propyl-1,11,13,16-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-2,4,6,12,14,16-hexaene |
|---|---|
| PubChem CID | 152849898 |
| Molecular Formula | C27H32N4 |
| Molecular Weight | 412.58 g/mol |
| Exact Mass | 412.26 |
| IUPAC Name | 15-tert-butyl-9-methyl-11-phenyl-9-propyl-1,11,13,16-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-2,4,6,12,14,16-hexaene |
| SMILES | CCCC1(C)Cc2ccccc2N2c3nc(C(C)(C)C)cnc3N(c3ccccc3)C21 |
| InChI | InChI=1S/C27H32N4/c1-6-16-27(5)17-19-12-10-11-15-21(19)31-24-23(28-18-22(29-24)26(2,3)4)30(25(27)31)20-13-8-7-9-14-20/h7-15,18,25H,6,16-17H2,1-5H3 |
| InChIKey | TUZCOZGAQNCAFQ-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.58 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |