C25H29F2N5O — CID 152850842
(4R)-6-[(4S)-6-(1-amino-3-methyliminoprop-1-en-2-yl)-7-(difluoromethyl)-4-methyl-3,4-dihydro-2H-quinolin-1-yl]-4-methyl-1,3,4,5-tetrahydro-1,5-benzodiazepin-2-one (PubChem CID 152850842) has the molecular formula C25H29F2N5O and a molecular weight of 453.54 g/mol. Its IUPAC name is (4R)-6-[(4S)-6-(1-amino-3-methyliminoprop-1-en-2-yl)-7-(difluoromethyl)-4-methyl-3,4-dihydro-2H-quinolin-1-yl]-4-methyl-1,3,4,5-tetrahydro-1,5-benzodiazepin-2-one.
| Compound Name | (4R)-6-[(4S)-6-(1-amino-3-methyliminoprop-1-en-2-yl)-7-(difluoromethyl)-4-methyl-3,4-dihydro-2H-quinolin-1-yl]-4-methyl-1,3,4,5-tetrahydro-1,5-benzodiazepin-2-one |
|---|---|
| PubChem CID | 152850842 |
| Molecular Formula | C25H29F2N5O |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.23 |
| IUPAC Name | (4R)-6-[(4S)-6-(1-amino-3-methyliminoprop-1-en-2-yl)-7-(difluoromethyl)-4-methyl-3,4-dihydro-2H-quinolin-1-yl]-4-methyl-1,3,4,5-tetrahydro-1,5-benzodiazepin-2-one |
| SMILES | C/N=C/C(=CN)c1cc2c(cc1C(F)F)N(c1cccc3c1N[C@H](C)CC(=O)N3)CC[C@@H]2C |
| InChI | InChI=1S/C25H29F2N5O/c1-14-7-8-32(21-6-4-5-20-24(21)30-15(2)9-23(33)31-20)22-11-19(25(26)27)18(10-17(14)22)16(12-28)13-29-3/h4-6,10-15,25,30H,7-9,28H2,1-3H3,(H,31,33)/b16-12?,29-13+/t14-,15+/m0/s1 |
| InChIKey | XGNGYIZNPKMENU-ADQSXAAESA-N |
| XLogP | 5.41 |
| TPSA | 82.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|