About 8-chloro-11-(1-methylpiperidin-4-ylidene)-5,6-dihydroimidazo[2,1-b][3]benzazepine
8-chloro-11-(1-methylpiperidin-4-ylidene)-5,6-dihydroimidazo[2,1-b][3]benzazepine (PubChem CID 15285356) has the molecular formula C18H20ClN3
and a molecular weight of 313.83 g/mol. Its IUPAC name is 8-chloro-11-(1-methylpiperidin-4-ylidene)-5,6-dihydroimidazo[2,1-b][3]benzazepine.
Molecular Properties
| Compound Name | 8-chloro-11-(1-methylpiperidin-4-ylidene)-5,6-dihydroimidazo[2,1-b][3]benzazepine |
| PubChem CID | 15285356 |
| Molecular Formula | C18H20ClN3 |
| Molecular Weight | 313.83 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | 8-chloro-11-(1-methylpiperidin-4-ylidene)-5,6-dihydroimidazo[2,1-b][3]benzazepine |
| SMILES | CN1CCC(=C2c3ccc(Cl)cc3CCn3ccnc32)CC1 |
| InChI | InChI=1S/C18H20ClN3/c1-21-8-4-13(5-9-21)17-16-3-2-15(19)12-14(16)6-10-22-11-7-20-18(17)22/h2-3,7,11-12H,4-6,8-10H2,1H3 |
| InChIKey | YABVGPCMUUNLCT-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.83 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|
Analyze 8-chloro-11-(1-methylpiperidin-4-ylidene)-5,6-dihydroimidazo[2,1-b][3]benzazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-chloro-11-(1-methylpiperidin-4-ylidene)-5,6-dihydroimidazo[2,1-b][3]benzazepine?
The IUPAC name of 8-chloro-11-(1-methylpiperidin-4-ylidene)-5,6-dihydroimidazo[2,1-b][3]benzazepine (CID 15285356) is 8-chloro-11-(1-methylpiperidin-4-ylidene)-5,6-dihydroimidazo[2,1-b][3]benzazepine.
What is the SMILES notation for 8-chloro-11-(1-methylpiperidin-4-ylidene)-5,6-dihydroimidazo[2,1-b][3]benzazepine?
The canonical SMILES for 8-chloro-11-(1-methylpiperidin-4-ylidene)-5,6-dihydroimidazo[2,1-b][3]benzazepine is CN1CCC(=C2c3ccc(Cl)cc3CCn3ccnc32)CC1.
What is the InChIKey of 8-chloro-11-(1-methylpiperidin-4-ylidene)-5,6-dihydroimidazo[2,1-b][3]benzazepine?
The InChIKey is YABVGPCMUUNLCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20ClN3/c1-21-8-4-13(5-9-21)17-16-3-2-15(19)12-14(16)6-10-22-11-7-20-18(17)22/h2-3,7,11-12H,4-6,8-10H2,1H3.
What are the key properties of 8-chloro-11-(1-methylpiperidin-4-ylidene)-5,6-dihydroimidazo[2,1-b][3]benzazepine?
8-chloro-11-(1-methylpiperidin-4-ylidene)-5,6-dihydroimidazo[2,1-b][3]benzazepine has a molecular weight of 313.83 g/mol, XLogP of 3.62, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-chloro-11-(1-methylpiperidin-4-ylidene)-5,6-dihydroimidazo[2,1-b][3]benzazepine is sourced from PubChem (CID 15285356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).