C10H13F2NO — CID 152853615
1-[(1S,2S,5R)-6,6-difluoro-2-prop-1-en-2-yl-3-azabicyclo[3.1.0]hexan-3-yl]ethanone (PubChem CID 152853615) has the molecular formula C10H13F2NO and a molecular weight of 201.22 g/mol. Its IUPAC name is 1-[(1S,2S,5R)-6,6-difluoro-2-prop-1-en-2-yl-3-azabicyclo[3.1.0]hexan-3-yl]ethanone.
| Compound Name | 1-[(1S,2S,5R)-6,6-difluoro-2-prop-1-en-2-yl-3-azabicyclo[3.1.0]hexan-3-yl]ethanone |
|---|---|
| PubChem CID | 152853615 |
| Molecular Formula | C10H13F2NO |
| Molecular Weight | 201.22 g/mol |
| Exact Mass | 201.10 |
| IUPAC Name | 1-[(1S,2S,5R)-6,6-difluoro-2-prop-1-en-2-yl-3-azabicyclo[3.1.0]hexan-3-yl]ethanone |
| SMILES | C=C(C)[C@@H]1[C@@H]2[C@H](CN1C(C)=O)C2(F)F |
| InChI | InChI=1S/C10H13F2NO/c1-5(2)9-8-7(10(8,11)12)4-13(9)6(3)14/h7-9H,1,4H2,2-3H3/t7-,8-,9+/m0/s1 |
| InChIKey | TVVXZJDPYANRDU-XHNCKOQMSA-N |
| XLogP | 1.67 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.22 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|