C34H42N2O3S — CID 15285553
2-(3,4-diethoxyphenyl)-7-(6-methoxy-3,4-dihydro-1H-isoquinolin-2-yl)-2-(4-methylphenyl)sulfanylheptanenitrile (PubChem CID 15285553) has the molecular formula C34H42N2O3S and a molecular weight of 558.79 g/mol. Its IUPAC name is 2-(3,4-diethoxyphenyl)-7-(6-methoxy-3,4-dihydro-1H-isoquinolin-2-yl)-2-(4-methylphenyl)sulfanylheptanenitrile.
| Compound Name | 2-(3,4-diethoxyphenyl)-7-(6-methoxy-3,4-dihydro-1H-isoquinolin-2-yl)-2-(4-methylphenyl)sulfanylheptanenitrile |
|---|---|
| PubChem CID | 15285553 |
| Molecular Formula | C34H42N2O3S |
| Molecular Weight | 558.79 g/mol |
| Exact Mass | 558.29 |
| IUPAC Name | 2-(3,4-diethoxyphenyl)-7-(6-methoxy-3,4-dihydro-1H-isoquinolin-2-yl)-2-(4-methylphenyl)sulfanylheptanenitrile |
| SMILES | CCOc1ccc(C(C#N)(CCCCCN2CCc3cc(OC)ccc3C2)Sc2ccc(C)cc2)cc1OCC |
| InChI | InChI=1S/C34H42N2O3S/c1-5-38-32-17-13-29(23-33(32)39-6-2)34(25-35,40-31-15-10-26(3)11-16-31)19-8-7-9-20-36-21-18-27-22-30(37-4)14-12-28(27)24-36/h10-17,22-23H,5-9,18-21,24H2,1-4H3 |
| InChIKey | UHAROVOYHWBKDC-UHFFFAOYSA-N |
| XLogP | 7.93 |
| TPSA | 54.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.79 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|