C14H22N2O6S3 — CID 152855934
1-(2-methyl-5-oxopyrrolidin-1-yl)oxy-1-oxo-4-(1,2,3,4-tetrahydropyridin-2-yldisulfanyl)butane-2-sulfonic acid (PubChem CID 152855934) has the molecular formula C14H22N2O6S3 and a molecular weight of 410.54 g/mol. Its IUPAC name is 1-(2-methyl-5-oxopyrrolidin-1-yl)oxy-1-oxo-4-(1,2,3,4-tetrahydropyridin-2-yldisulfanyl)butane-2-sulfonic acid.
| Compound Name | 1-(2-methyl-5-oxopyrrolidin-1-yl)oxy-1-oxo-4-(1,2,3,4-tetrahydropyridin-2-yldisulfanyl)butane-2-sulfonic acid |
|---|---|
| PubChem CID | 152855934 |
| Molecular Formula | C14H22N2O6S3 |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.06 |
| IUPAC Name | 1-(2-methyl-5-oxopyrrolidin-1-yl)oxy-1-oxo-4-(1,2,3,4-tetrahydropyridin-2-yldisulfanyl)butane-2-sulfonic acid |
| SMILES | CC1CCC(=O)N1OC(=O)C(CCSSC1CCC=CN1)S(=O)(=O)O |
| InChI | InChI=1S/C14H22N2O6S3/c1-10-5-6-13(17)16(10)22-14(18)11(25(19,20)21)7-9-23-24-12-4-2-3-8-15-12/h3,8,10-12,15H,2,4-7,9H2,1H3,(H,19,20,21) |
| InChIKey | TWOJMGVZHHCJBC-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|