About (3S)-3-[(1S,2S,3R)-3-methoxy-2-nitro-5-oxocyclohexyl]-3-methyloxan-2-one
(3S)-3-[(1S,2S,3R)-3-methoxy-2-nitro-5-oxocyclohexyl]-3-methyloxan-2-one (PubChem CID 15285617) has the molecular formula C13H19NO6
and a molecular weight of 285.30 g/mol. Its IUPAC name is (3S)-3-[(1S,2S,3R)-3-methoxy-2-nitro-5-oxocyclohexyl]-3-methyloxan-2-one.
Molecular Properties
| Compound Name | (3S)-3-[(1S,2S,3R)-3-methoxy-2-nitro-5-oxocyclohexyl]-3-methyloxan-2-one |
| PubChem CID | 15285617 |
| Molecular Formula | C13H19NO6 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | (3S)-3-[(1S,2S,3R)-3-methoxy-2-nitro-5-oxocyclohexyl]-3-methyloxan-2-one |
| SMILES | CO[C@@H]1CC(=O)C[C@@H]([C@]2(C)CCCOC2=O)[C@@H]1[N+](=O)[O-] |
| InChI | InChI=1S/C13H19NO6/c1-13(4-3-5-20-12(13)16)9-6-8(15)7-10(19-2)11(9)14(17)18/h9-11H,3-7H2,1-2H3/t9-,10-,11+,13+/m1/s1 |
| InChIKey | CLLRERRNCHIRPX-DCQANWLSSA-N |
| XLogP | 0.97 |
| TPSA | 95.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (3S)-3-[(1S,2S,3R)-3-methoxy-2-nitro-5-oxocyclohexyl]-3-methyloxan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-[(1S,2S,3R)-3-methoxy-2-nitro-5-oxocyclohexyl]-3-methyloxan-2-one?
The IUPAC name of (3S)-3-[(1S,2S,3R)-3-methoxy-2-nitro-5-oxocyclohexyl]-3-methyloxan-2-one (CID 15285617) is (3S)-3-[(1S,2S,3R)-3-methoxy-2-nitro-5-oxocyclohexyl]-3-methyloxan-2-one.
What is the SMILES notation for (3S)-3-[(1S,2S,3R)-3-methoxy-2-nitro-5-oxocyclohexyl]-3-methyloxan-2-one?
The canonical SMILES for (3S)-3-[(1S,2S,3R)-3-methoxy-2-nitro-5-oxocyclohexyl]-3-methyloxan-2-one is CO[C@@H]1CC(=O)C[C@@H]([C@]2(C)CCCOC2=O)[C@@H]1[N+](=O)[O-].
What is the InChIKey of (3S)-3-[(1S,2S,3R)-3-methoxy-2-nitro-5-oxocyclohexyl]-3-methyloxan-2-one?
The InChIKey is CLLRERRNCHIRPX-DCQANWLSSA-N. The full InChI is InChI=1S/C13H19NO6/c1-13(4-3-5-20-12(13)16)9-6-8(15)7-10(19-2)11(9)14(17)18/h9-11H,3-7H2,1-2H3/t9-,10-,11+,13+/m1/s1.
What are the key properties of (3S)-3-[(1S,2S,3R)-3-methoxy-2-nitro-5-oxocyclohexyl]-3-methyloxan-2-one?
(3S)-3-[(1S,2S,3R)-3-methoxy-2-nitro-5-oxocyclohexyl]-3-methyloxan-2-one has a molecular weight of 285.30 g/mol, XLogP of 0.97, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-[(1S,2S,3R)-3-methoxy-2-nitro-5-oxocyclohexyl]-3-methyloxan-2-one is sourced from PubChem (CID 15285617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).