About N-(6-ethenylcyclohexa-1,5-dien-1-yl)ethanimine
N-(6-ethenylcyclohexa-1,5-dien-1-yl)ethanimine (PubChem CID 152858957) has the molecular formula C10H13N
and a molecular weight of 147.22 g/mol. Its IUPAC name is N-(6-ethenylcyclohexa-1,5-dien-1-yl)ethanimine.
Molecular Properties
| Compound Name | N-(6-ethenylcyclohexa-1,5-dien-1-yl)ethanimine |
| PubChem CID | 152858957 |
| Molecular Formula | C10H13N |
| Molecular Weight | 147.22 g/mol |
| Exact Mass | 147.10 |
| IUPAC Name | N-(6-ethenylcyclohexa-1,5-dien-1-yl)ethanimine |
| SMILES | C=CC1=CCCC=C1/N=C/C |
| InChI | InChI=1S/C10H13N/c1-3-9-7-5-6-8-10(9)11-4-2/h3-4,7-8H,1,5-6H2,2H3/b11-4+ |
| InChIKey | TXDGDZSKHMKWOC-NYYWCZLTSA-N |
| XLogP | 2.87 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.22 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-(6-ethenylcyclohexa-1,5-dien-1-yl)ethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(6-ethenylcyclohexa-1,5-dien-1-yl)ethanimine?
The IUPAC name of N-(6-ethenylcyclohexa-1,5-dien-1-yl)ethanimine (CID 152858957) is N-(6-ethenylcyclohexa-1,5-dien-1-yl)ethanimine.
What is the SMILES notation for N-(6-ethenylcyclohexa-1,5-dien-1-yl)ethanimine?
The canonical SMILES for N-(6-ethenylcyclohexa-1,5-dien-1-yl)ethanimine is C=CC1=CCCC=C1/N=C/C.
What is the InChIKey of N-(6-ethenylcyclohexa-1,5-dien-1-yl)ethanimine?
The InChIKey is TXDGDZSKHMKWOC-NYYWCZLTSA-N. The full InChI is InChI=1S/C10H13N/c1-3-9-7-5-6-8-10(9)11-4-2/h3-4,7-8H,1,5-6H2,2H3/b11-4+.
What are the key properties of N-(6-ethenylcyclohexa-1,5-dien-1-yl)ethanimine?
N-(6-ethenylcyclohexa-1,5-dien-1-yl)ethanimine has a molecular weight of 147.22 g/mol, XLogP of 2.87, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(6-ethenylcyclohexa-1,5-dien-1-yl)ethanimine is sourced from PubChem (CID 152858957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).