C34H33N5O2 — CID 152859248
2-(2-amino-5-phenylphenyl)-1-[2-[[1-[2-(1H-indol-3-yl)acetyl]piperidin-4-yl]methyl]pyrimidin-5-yl]ethanone (PubChem CID 152859248) has the molecular formula C34H33N5O2 and a molecular weight of 543.67 g/mol. Its IUPAC name is 2-(2-amino-5-phenylphenyl)-1-[2-[[1-[2-(1H-indol-3-yl)acetyl]piperidin-4-yl]methyl]pyrimidin-5-yl]ethanone.
| Compound Name | 2-(2-amino-5-phenylphenyl)-1-[2-[[1-[2-(1H-indol-3-yl)acetyl]piperidin-4-yl]methyl]pyrimidin-5-yl]ethanone |
|---|---|
| PubChem CID | 152859248 |
| Molecular Formula | C34H33N5O2 |
| Molecular Weight | 543.67 g/mol |
| Exact Mass | 543.26 |
| IUPAC Name | 2-(2-amino-5-phenylphenyl)-1-[2-[[1-[2-(1H-indol-3-yl)acetyl]piperidin-4-yl]methyl]pyrimidin-5-yl]ethanone |
| SMILES | Nc1ccc(-c2ccccc2)cc1CC(=O)c1cnc(CC2CCN(C(=O)Cc3c[nH]c4ccccc34)CC2)nc1 |
| InChI | InChI=1S/C34H33N5O2/c35-30-11-10-25(24-6-2-1-3-7-24)17-26(30)18-32(40)28-21-37-33(38-22-28)16-23-12-14-39(15-13-23)34(41)19-27-20-36-31-9-5-4-8-29(27)31/h1-11,17,20-23,36H,12-16,18-19,35H2 |
| InChIKey | TXERBOMWNLIBMJ-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 104.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.67 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|