About (3Z)-2-methylidenehexa-3,5-dienimidamide
(3Z)-2-methylidenehexa-3,5-dienimidamide (PubChem CID 152860401) has the molecular formula C7H10N2
and a molecular weight of 122.17 g/mol. Its IUPAC name is (3Z)-2-methylidenehexa-3,5-dienimidamide.
Molecular Properties
| Compound Name | (3Z)-2-methylidenehexa-3,5-dienimidamide |
| PubChem CID | 152860401 |
| Molecular Formula | C7H10N2 |
| Molecular Weight | 122.17 g/mol |
| Exact Mass | 122.08 |
| IUPAC Name | (3Z)-2-methylidenehexa-3,5-dienimidamide |
| SMILES | [H]/N=C(\N)C(=C)/C=C\C=C |
| InChI | InChI=1S/C7H10N2/c1-3-4-5-6(2)7(8)9/h3-5H,1-2H2,(H3,8,9)/b5-4- |
| InChIKey | TXKMDSJQHJSYOX-PLNGDYQASA-N |
| XLogP | 1.22 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.17 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-2-methylidenehexa-3,5-dienimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-2-methylidenehexa-3,5-dienimidamide?
The IUPAC name of (3Z)-2-methylidenehexa-3,5-dienimidamide (CID 152860401) is (3Z)-2-methylidenehexa-3,5-dienimidamide.
What is the SMILES notation for (3Z)-2-methylidenehexa-3,5-dienimidamide?
The canonical SMILES for (3Z)-2-methylidenehexa-3,5-dienimidamide is [H]/N=C(\N)C(=C)/C=C\C=C.
What is the InChIKey of (3Z)-2-methylidenehexa-3,5-dienimidamide?
The InChIKey is TXKMDSJQHJSYOX-PLNGDYQASA-N. The full InChI is InChI=1S/C7H10N2/c1-3-4-5-6(2)7(8)9/h3-5H,1-2H2,(H3,8,9)/b5-4-.
What are the key properties of (3Z)-2-methylidenehexa-3,5-dienimidamide?
(3Z)-2-methylidenehexa-3,5-dienimidamide has a molecular weight of 122.17 g/mol, XLogP of 1.22, 3 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-2-methylidenehexa-3,5-dienimidamide is sourced from PubChem (CID 152860401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).