C28H33F3N7O2P — CID 152861034
2-N-[4-[4-(dimethylamino)piperidin-1-yl]-3-(trifluoromethoxy)phenyl]-4-N-(2-dimethylphosphorylphenyl)-7H-pyrrolo[2,3-d]pyrimidine-2,4-diamine (PubChem CID 152861034) has the molecular formula C28H33F3N7O2P and a molecular weight of 587.59 g/mol. Its IUPAC name is 2-N-[4-[4-(dimethylamino)piperidin-1-yl]-3-(trifluoromethoxy)phenyl]-4-N-(2-dimethylphosphorylphenyl)-7H-pyrrolo[2,3-d]pyrimidine-2,4-diamine.
| Compound Name | 2-N-[4-[4-(dimethylamino)piperidin-1-yl]-3-(trifluoromethoxy)phenyl]-4-N-(2-dimethylphosphorylphenyl)-7H-pyrrolo[2,3-d]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 152861034 |
| Molecular Formula | C28H33F3N7O2P |
| Molecular Weight | 587.59 g/mol |
| Exact Mass | 587.24 |
| IUPAC Name | 2-N-[4-[4-(dimethylamino)piperidin-1-yl]-3-(trifluoromethoxy)phenyl]-4-N-(2-dimethylphosphorylphenyl)-7H-pyrrolo[2,3-d]pyrimidine-2,4-diamine |
| SMILES | CN(C)C1CCN(c2ccc(Nc3nc(Nc4ccccc4P(C)(C)=O)c4cc[nH]c4n3)cc2OC(F)(F)F)CC1 |
| InChI | InChI=1S/C28H33F3N7O2P/c1-37(2)19-12-15-38(16-13-19)22-10-9-18(17-23(22)40-28(29,30)31)33-27-35-25-20(11-14-32-25)26(36-27)34-21-7-5-6-8-24(21)41(3,4)39/h5-11,14,17,19H,12-13,15-16H2,1-4H3,(H3,32,33,34,35,36) |
| InChIKey | TXNNXDLURRRTNZ-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 98.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.59 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|