About Murrayamine O
Murrayamine O (PubChem CID 15286150) has the molecular formula C23H27NO2
and a molecular weight of 349.50 g/mol. Its IUPAC name is (16R,19S,21R)-12,15,15,19-tetramethyl-14-oxa-3-azapentacyclo[11.8.0.02,10.04,9.016,21]henicosa-1(13),2(10),4,6,8,11-hexaen-19-ol.
Molecular Properties
| Compound Name | Murrayamine O |
| PubChem CID | 15286150 |
| Molecular Formula | C23H27NO2 |
| Molecular Weight | 349.50 g/mol |
| Exact Mass | 349.20 |
| IUPAC Name | (16R,19S,21R)-12,15,15,19-tetramethyl-14-oxa-3-azapentacyclo[11.8.0.02,10.04,9.016,21]henicosa-1(13),2(10),4,6,8,11-hexaen-19-ol |
| SMILES | CC1=CC2=C(C3=C1OC([C@H]4[C@H]3C[C@@](CC4)(C)O)(C)C)NC5=CC=CC=C52 |
| InChI | InChI=1S/C23H27NO2/c1-13-11-15-14-7-5-6-8-18(14)24-20(15)19-16-12-23(4,25)10-9-17(16)22(2,3)26-21(13)19/h5-8,11,16-17,24-25H,9-10,12H2,1-4H3/t16-,17-,23+/m1/s1 |
| InChIKey | XGSIRVCZJNNOBQ-QZMQVMSPSA-N |
| XLogP | 4.80 |
| TPSA | 45.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | 562 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.50 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze Murrayamine O with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Murrayamine O?
The IUPAC name of Murrayamine O (CID 15286150) is (16R,19S,21R)-12,15,15,19-tetramethyl-14-oxa-3-azapentacyclo[11.8.0.02,10.04,9.016,21]henicosa-1(13),2(10),4,6,8,11-hexaen-19-ol.
What is the SMILES notation for Murrayamine O?
The canonical SMILES for Murrayamine O is CC1=CC2=C(C3=C1OC([C@H]4[C@H]3C[C@@](CC4)(C)O)(C)C)NC5=CC=CC=C52.
What is the InChIKey of Murrayamine O?
The InChIKey is XGSIRVCZJNNOBQ-QZMQVMSPSA-N. The full InChI is InChI=1S/C23H27NO2/c1-13-11-15-14-7-5-6-8-18(14)24-20(15)19-16-12-23(4,25)10-9-17(16)22(2,3)26-21(13)19/h5-8,11,16-17,24-25H,9-10,12H2,1-4H3/t16-,17-,23+/m1/s1.
What are the key properties of Murrayamine O?
Murrayamine O has a molecular weight of 349.50 g/mol, XLogP of 4.80, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for Murrayamine O is sourced from PubChem (CID 15286150), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).