C15H21N3 — CID 15286763
7,17-diazatricyclo[8.7.0.011,16]heptadeca-1(10),11,13,15-tetraen-2-amine (PubChem CID 15286763) has the molecular formula C15H21N3 and a molecular weight of 243.35 g/mol. Its IUPAC name is 7,17-diazatricyclo[8.7.0.011,16]heptadeca-1(10),11,13,15-tetraen-2-amine.
| Compound Name | 7,17-diazatricyclo[8.7.0.011,16]heptadeca-1(10),11,13,15-tetraen-2-amine |
|---|---|
| PubChem CID | 15286763 |
| Molecular Formula | C15H21N3 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.17 |
| IUPAC Name | 7,17-diazatricyclo[8.7.0.011,16]heptadeca-1(10),11,13,15-tetraen-2-amine |
| SMILES | NC1CCCCNCCc2c1[nH]c1ccccc21 |
| InChI | InChI=1S/C15H21N3/c16-13-6-3-4-9-17-10-8-12-11-5-1-2-7-14(11)18-15(12)13/h1-2,5,7,13,17-18H,3-4,6,8-10,16H2 |
| InChIKey | UWSGEWMTRVDJPU-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 53.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|