C13H24N2 — CID 15287019
(2R,7S,9R)-7-propyl-1,6-diazatricyclo[7.3.0.02,6]dodecane (PubChem CID 15287019) has the molecular formula C13H24N2 and a molecular weight of 208.35 g/mol. Its IUPAC name is (2R,7S,9R)-7-propyl-1,6-diazatricyclo[7.3.0.02,6]dodecane.
| Compound Name | (2R,7S,9R)-7-propyl-1,6-diazatricyclo[7.3.0.02,6]dodecane |
|---|---|
| PubChem CID | 15287019 |
| Molecular Formula | C13H24N2 |
| Molecular Weight | 208.35 g/mol |
| Exact Mass | 208.19 |
| IUPAC Name | (2R,7S,9R)-7-propyl-1,6-diazatricyclo[7.3.0.02,6]dodecane |
| SMILES | CCC[C@H]1C[C@H]2CCCN2[C@@H]2CCCN12 |
| InChI | InChI=1S/C13H24N2/c1-2-5-11-10-12-6-3-8-15(12)13-7-4-9-14(11)13/h11-13H,2-10H2,1H3/t11-,12+,13+/m0/s1 |
| InChIKey | VJJWHOBPDFRQRH-YNEHKIRRSA-N |
| XLogP | 2.45 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.35 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |