C13H15N — CID 15287247
9-methyl-6,7,8,9-tetrahydropyrido[1,2-a]indole (PubChem CID 15287247) has the molecular formula C13H15N and a molecular weight of 185.27 g/mol. Its IUPAC name is 9-methyl-6,7,8,9-tetrahydropyrido[1,2-a]indole.
| Compound Name | 9-methyl-6,7,8,9-tetrahydropyrido[1,2-a]indole |
|---|---|
| PubChem CID | 15287247 |
| Molecular Formula | C13H15N |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | 9-methyl-6,7,8,9-tetrahydropyrido[1,2-a]indole |
| SMILES | CC1CCCn2c1cc1ccccc12 |
| InChI | InChI=1S/C13H15N/c1-10-5-4-8-14-12-7-3-2-6-11(12)9-13(10)14/h2-3,6-7,9-10H,4-5,8H2,1H3 |
| InChIKey | WZBCBJMSOXECQN-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |