C13H15N — CID 15287251
3,4-dimethyl-2,3-dihydro-1H-pyrrolo[1,2-a]indole (PubChem CID 15287251) has the molecular formula C13H15N and a molecular weight of 185.27 g/mol. Its IUPAC name is 3,4-dimethyl-2,3-dihydro-1H-pyrrolo[1,2-a]indole.
| Compound Name | 3,4-dimethyl-2,3-dihydro-1H-pyrrolo[1,2-a]indole |
|---|---|
| PubChem CID | 15287251 |
| Molecular Formula | C13H15N |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | 3,4-dimethyl-2,3-dihydro-1H-pyrrolo[1,2-a]indole |
| SMILES | Cc1c2n(c3ccccc13)CCC2C |
| InChI | InChI=1S/C13H15N/c1-9-7-8-14-12-6-4-3-5-11(12)10(2)13(9)14/h3-6,9H,7-8H2,1-2H3 |
| InChIKey | ARZYQMBLKVERBU-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |