C21H25ClN2O3 — CID 15287515
methyl (1S,10R,15R,18S,19R,20S)-10-chloro-18-hydroxy-11,12,14,15,16,17,18,19,20,21-decahydro-1H-yohimban-19-carboxylate (PubChem CID 15287515) has the molecular formula C21H25ClN2O3 and a molecular weight of 388.90 g/mol. Its IUPAC name is methyl (1S,10R,15R,18S,19R,20S)-10-chloro-18-hydroxy-11,12,14,15,16,17,18,19,20,21-decahydro-1H-yohimban-19-carboxylate.
| Compound Name | methyl (1S,10R,15R,18S,19R,20S)-10-chloro-18-hydroxy-11,12,14,15,16,17,18,19,20,21-decahydro-1H-yohimban-19-carboxylate |
|---|---|
| PubChem CID | 15287515 |
| Molecular Formula | C21H25ClN2O3 |
| Molecular Weight | 388.90 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | methyl (1S,10R,15R,18S,19R,20S)-10-chloro-18-hydroxy-11,12,14,15,16,17,18,19,20,21-decahydro-1H-yohimban-19-carboxylate |
| SMILES | COC(=O)[C@@H]1[C@H]2C[C@H]3C4=Nc5ccccc5[C@]4(Cl)CCN3C[C@@H]2CC[C@@H]1O |
| InChI | InChI=1S/C21H25ClN2O3/c1-27-20(26)18-13-10-16-19-21(22,14-4-2-3-5-15(14)23-19)8-9-24(16)11-12(13)6-7-17(18)25/h2-5,12-13,16-18,25H,6-11H2,1H3/t12-,13-,16-,17-,18+,21+/m0/s1 |
| InChIKey | OMQYKJNWBCAVMP-XCJYFPORSA-N |
| XLogP | 2.86 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.90 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|