C42H27N3 — CID 152875152
16-(4,6-diphenylpyrimidin-2-yl)-15-phenyl-16-azapentacyclo[12.6.1.02,7.08,13.017,21]henicosa-1(21),2,4,6,8,10,12,14,17,19-decaene (PubChem CID 152875152) has the molecular formula C42H27N3 and a molecular weight of 573.70 g/mol. Its IUPAC name is 16-(4,6-diphenylpyrimidin-2-yl)-15-phenyl-16-azapentacyclo[12.6.1.02,7.08,13.017,21]henicosa-1(21),2,4,6,8,10,12,14,17,19-decaene.
| Compound Name | 16-(4,6-diphenylpyrimidin-2-yl)-15-phenyl-16-azapentacyclo[12.6.1.02,7.08,13.017,21]henicosa-1(21),2,4,6,8,10,12,14,17,19-decaene |
|---|---|
| PubChem CID | 152875152 |
| Molecular Formula | C42H27N3 |
| Molecular Weight | 573.70 g/mol |
| Exact Mass | 573.22 |
| IUPAC Name | 16-(4,6-diphenylpyrimidin-2-yl)-15-phenyl-16-azapentacyclo[12.6.1.02,7.08,13.017,21]henicosa-1(21),2,4,6,8,10,12,14,17,19-decaene |
| SMILES | c1ccc(-c2cc(-c3ccccc3)nc(-n3c(-c4ccccc4)c4c5c(cccc53)-c3ccccc3-c3ccccc3-4)n2)cc1 |
| InChI | InChI=1S/C42H27N3/c1-4-15-28(16-5-1)36-27-37(29-17-6-2-7-18-29)44-42(43-36)45-38-26-14-25-34-32-22-11-10-21-31(32)33-23-12-13-24-35(33)40(39(34)38)41(45)30-19-8-3-9-20-30/h1-27H |
| InChIKey | UAEJJDRNUYJCSG-UHFFFAOYSA-N |
| XLogP | 10.74 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.70 |
| LogP ≤ 5 | 10.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |