C26H24ClN3O3 — CID 152875287
2-[4-(5-chloropyrimidin-2-yl)-2,6-dimethylphenyl]-4-(4-oxo-4-pyridin-2-ylbutyl)cyclopentane-1,3-dione (PubChem CID 152875287) has the molecular formula C26H24ClN3O3 and a molecular weight of 461.95 g/mol. Its IUPAC name is 2-[4-(5-chloropyrimidin-2-yl)-2,6-dimethylphenyl]-4-(4-oxo-4-pyridin-2-ylbutyl)cyclopentane-1,3-dione.
| Compound Name | 2-[4-(5-chloropyrimidin-2-yl)-2,6-dimethylphenyl]-4-(4-oxo-4-pyridin-2-ylbutyl)cyclopentane-1,3-dione |
|---|---|
| PubChem CID | 152875287 |
| Molecular Formula | C26H24ClN3O3 |
| Molecular Weight | 461.95 g/mol |
| Exact Mass | 461.15 |
| IUPAC Name | 2-[4-(5-chloropyrimidin-2-yl)-2,6-dimethylphenyl]-4-(4-oxo-4-pyridin-2-ylbutyl)cyclopentane-1,3-dione |
| SMILES | Cc1cc(-c2ncc(Cl)cn2)cc(C)c1C1C(=O)CC(CCCC(=O)c2ccccn2)C1=O |
| InChI | InChI=1S/C26H24ClN3O3/c1-15-10-18(26-29-13-19(27)14-30-26)11-16(2)23(15)24-22(32)12-17(25(24)33)6-5-8-21(31)20-7-3-4-9-28-20/h3-4,7,9-11,13-14,17,24H,5-6,8,12H2,1-2H3 |
| InChIKey | UAFBZLCCPKHAPE-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 89.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.95 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|