About (2S)-2-[[6-chloro-2-(3,3-difluorocyclobutyl)pyrimidin-4-yl]-methylamino]-3-methylbutan-1-ol
(2S)-2-[[6-chloro-2-(3,3-difluorocyclobutyl)pyrimidin-4-yl]-methylamino]-3-methylbutan-1-ol (PubChem CID 152877406) has the molecular formula C14H20ClF2N3O
and a molecular weight of 319.78 g/mol. Its IUPAC name is (2S)-2-[[6-chloro-2-(3,3-difluorocyclobutyl)pyrimidin-4-yl]-methylamino]-3-methylbutan-1-ol.
Molecular Properties
| Compound Name | (2S)-2-[[6-chloro-2-(3,3-difluorocyclobutyl)pyrimidin-4-yl]-methylamino]-3-methylbutan-1-ol |
| PubChem CID | 152877406 |
| Molecular Formula | C14H20ClF2N3O |
| Molecular Weight | 319.78 g/mol |
| Exact Mass | 319.13 |
| IUPAC Name | (2S)-2-[[6-chloro-2-(3,3-difluorocyclobutyl)pyrimidin-4-yl]-methylamino]-3-methylbutan-1-ol |
| SMILES | CC(C)[C@@H](CO)N(C)c1cc(Cl)nc(C2CC(F)(F)C2)n1 |
| InChI | InChI=1S/C14H20ClF2N3O/c1-8(2)10(7-21)20(3)12-4-11(15)18-13(19-12)9-5-14(16,17)6-9/h4,8-10,21H,5-7H2,1-3H3/t10-/m1/s1 |
| InChIKey | UARVBBVSAXPZLV-SNVBAGLBSA-N |
| XLogP | 3.10 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.78 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2S)-2-[[6-chloro-2-(3,3-difluorocyclobutyl)pyrimidin-4-yl]-methylamino]-3-methylbutan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-[[6-chloro-2-(3,3-difluorocyclobutyl)pyrimidin-4-yl]-methylamino]-3-methylbutan-1-ol?
The IUPAC name of (2S)-2-[[6-chloro-2-(3,3-difluorocyclobutyl)pyrimidin-4-yl]-methylamino]-3-methylbutan-1-ol (CID 152877406) is (2S)-2-[[6-chloro-2-(3,3-difluorocyclobutyl)pyrimidin-4-yl]-methylamino]-3-methylbutan-1-ol.
What is the SMILES notation for (2S)-2-[[6-chloro-2-(3,3-difluorocyclobutyl)pyrimidin-4-yl]-methylamino]-3-methylbutan-1-ol?
The canonical SMILES for (2S)-2-[[6-chloro-2-(3,3-difluorocyclobutyl)pyrimidin-4-yl]-methylamino]-3-methylbutan-1-ol is CC(C)[C@@H](CO)N(C)c1cc(Cl)nc(C2CC(F)(F)C2)n1.
What is the InChIKey of (2S)-2-[[6-chloro-2-(3,3-difluorocyclobutyl)pyrimidin-4-yl]-methylamino]-3-methylbutan-1-ol?
The InChIKey is UARVBBVSAXPZLV-SNVBAGLBSA-N. The full InChI is InChI=1S/C14H20ClF2N3O/c1-8(2)10(7-21)20(3)12-4-11(15)18-13(19-12)9-5-14(16,17)6-9/h4,8-10,21H,5-7H2,1-3H3/t10-/m1/s1.
What are the key properties of (2S)-2-[[6-chloro-2-(3,3-difluorocyclobutyl)pyrimidin-4-yl]-methylamino]-3-methylbutan-1-ol?
(2S)-2-[[6-chloro-2-(3,3-difluorocyclobutyl)pyrimidin-4-yl]-methylamino]-3-methylbutan-1-ol has a molecular weight of 319.78 g/mol, XLogP of 3.10, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-[[6-chloro-2-(3,3-difluorocyclobutyl)pyrimidin-4-yl]-methylamino]-3-methylbutan-1-ol is sourced from PubChem (CID 152877406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).