C23H26N2OS — CID 15287741
N-[2-(6,6-dimethylhepta-2,4-diynylamino)ethyl]-2-naphthalen-1-ylsulfanylacetamide (PubChem CID 15287741) has the molecular formula C23H26N2OS and a molecular weight of 378.54 g/mol. Its IUPAC name is N-[2-(6,6-dimethylhepta-2,4-diynylamino)ethyl]-2-naphthalen-1-ylsulfanylacetamide.
| Compound Name | N-[2-(6,6-dimethylhepta-2,4-diynylamino)ethyl]-2-naphthalen-1-ylsulfanylacetamide |
|---|---|
| PubChem CID | 15287741 |
| Molecular Formula | C23H26N2OS |
| Molecular Weight | 378.54 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | N-[2-(6,6-dimethylhepta-2,4-diynylamino)ethyl]-2-naphthalen-1-ylsulfanylacetamide |
| SMILES | CC(C)(C)C#CC#CCNCCNC(=O)CSc1cccc2ccccc12 |
| InChI | InChI=1S/C23H26N2OS/c1-23(2,3)14-7-4-8-15-24-16-17-25-22(26)18-27-21-13-9-11-19-10-5-6-12-20(19)21/h5-6,9-13,24H,15-18H2,1-3H3,(H,25,26) |
| InChIKey | GQNZTUIPSKRHAZ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.54 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|