C44H34N2O+2 — CID 152881118
10-[3-(9,9-dimethylfluoren-2-yl)phenyl]-2-(1H-indol-3-yl)-2,3-dihydronaphtho[2,1-g][1,3]benzoxazole-1,3-diium (PubChem CID 152881118) has the molecular formula C44H34N2O+2 and a molecular weight of 606.77 g/mol. Its IUPAC name is 10-[3-(9,9-dimethylfluoren-2-yl)phenyl]-2-(1H-indol-3-yl)-2,3-dihydronaphtho[2,1-g][1,3]benzoxazole-1,3-diium.
| Compound Name | 10-[3-(9,9-dimethylfluoren-2-yl)phenyl]-2-(1H-indol-3-yl)-2,3-dihydronaphtho[2,1-g][1,3]benzoxazole-1,3-diium |
|---|---|
| PubChem CID | 152881118 |
| Molecular Formula | C44H34N2O+2 |
| Molecular Weight | 606.77 g/mol |
| Exact Mass | 606.27 |
| IUPAC Name | 10-[3-(9,9-dimethylfluoren-2-yl)phenyl]-2-(1H-indol-3-yl)-2,3-dihydronaphtho[2,1-g][1,3]benzoxazole-1,3-diium |
| SMILES | CC1(C)c2ccccc2-c2ccc(-c3cccc(-c4ccc5ccc6ccc7c(c6c5c4)[OH+]C(c4c[nH]c5ccccc45)[NH2+]7)c3)cc21 |
| InChI | InChI=1S/C44H32N2O/c1-44(2)37-12-5-3-10-32(37)33-20-18-31(24-38(33)44)29-9-7-8-28(22-29)30-17-15-26-14-16-27-19-21-40-42(41(27)35(26)23-30)47-43(46-40)36-25-45-39-13-6-4-11-34(36)39/h3-25,43,45-46H,1-2H3/p+2 |
| InChIKey | UBKDAMCQFYNYLO-UHFFFAOYSA-P |
| XLogP | 10.26 |
| TPSA | 45.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.77 |
| LogP ≤ 5 | 10.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|