C10H11NO — CID 152881590
8-oxa-11-azatricyclo[7.2.1.02,7]dodeca-2,4,6-triene (PubChem CID 152881590) has the molecular formula C10H11NO and a molecular weight of 161.20 g/mol. Its IUPAC name is 8-oxa-11-azatricyclo[7.2.1.02,7]dodeca-2,4,6-triene.
| Compound Name | 8-oxa-11-azatricyclo[7.2.1.02,7]dodeca-2,4,6-triene |
|---|---|
| PubChem CID | 152881590 |
| Molecular Formula | C10H11NO |
| Molecular Weight | 161.20 g/mol |
| Exact Mass | 161.08 |
| IUPAC Name | 8-oxa-11-azatricyclo[7.2.1.02,7]dodeca-2,4,6-triene |
| SMILES | c1ccc2c(c1)OC1CNC2C1 |
| InChI | InChI=1S/C10H11NO/c1-2-4-10-8(3-1)9-5-7(12-10)6-11-9/h1-4,7,9,11H,5-6H2 |
| InChIKey | UBOUWDUOOIWDPV-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.20 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |