C25H22Cl2F4N4O4 — CID 152887550
1-[(1S,5R)-6-[4-(3,4-dichloro-2-fluoroanilino)-7-(2-methoxyethoxy)quinazolin-6-yl]oxy-3-azabicyclo[3.1.1]heptan-3-yl]-2,2,2-trifluoroethanone (PubChem CID 152887550) has the molecular formula C25H22Cl2F4N4O4 and a molecular weight of 589.37 g/mol. Its IUPAC name is 1-[(1S,5R)-6-[4-(3,4-dichloro-2-fluoroanilino)-7-(2-methoxyethoxy)quinazolin-6-yl]oxy-3-azabicyclo[3.1.1]heptan-3-yl]-2,2,2-trifluoroethanone.
| Compound Name | 1-[(1S,5R)-6-[4-(3,4-dichloro-2-fluoroanilino)-7-(2-methoxyethoxy)quinazolin-6-yl]oxy-3-azabicyclo[3.1.1]heptan-3-yl]-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 152887550 |
| Molecular Formula | C25H22Cl2F4N4O4 |
| Molecular Weight | 589.37 g/mol |
| Exact Mass | 588.10 |
| IUPAC Name | 1-[(1S,5R)-6-[4-(3,4-dichloro-2-fluoroanilino)-7-(2-methoxyethoxy)quinazolin-6-yl]oxy-3-azabicyclo[3.1.1]heptan-3-yl]-2,2,2-trifluoroethanone |
| SMILES | COCCOc1cc2ncnc(Nc3ccc(Cl)c(Cl)c3F)c2cc1OC1[C@@H]2C[C@H]1CN(C(=O)C(F)(F)F)C2 |
| InChI | InChI=1S/C25H22Cl2F4N4O4/c1-37-4-5-38-18-8-17-14(23(33-11-32-17)34-16-3-2-15(26)20(27)21(16)28)7-19(18)39-22-12-6-13(22)10-35(9-12)24(36)25(29,30)31/h2-3,7-8,11-13,22H,4-6,9-10H2,1H3,(H,32,33,34)/t12-,13+,22? |
| InChIKey | UCULTWNOKWFAMB-LEBBGHJMSA-N |
| XLogP | 5.63 |
| TPSA | 85.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.37 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|