C21H22ClNO8 — CID 152888326
methyl 2-[[(4R,6R,8R,9Z,11E)-16-chloro-17,19-dihydroxy-4-methyl-2-oxo-3,7-dioxatricyclo[13.4.0.06,8]nonadeca-1(15),9,11,16,18-pentaen-13-ylidene]amino]oxyacetate (PubChem CID 152888326) has the molecular formula C21H22ClNO8 and a molecular weight of 451.86 g/mol. Its IUPAC name is methyl 2-[[(4R,6R,8R,9Z,11E)-16-chloro-17,19-dihydroxy-4-methyl-2-oxo-3,7-dioxatricyclo[13.4.0.06,8]nonadeca-1(15),9,11,16,18-pentaen-13-ylidene]amino]oxyacetate.
| Compound Name | methyl 2-[[(4R,6R,8R,9Z,11E)-16-chloro-17,19-dihydroxy-4-methyl-2-oxo-3,7-dioxatricyclo[13.4.0.06,8]nonadeca-1(15),9,11,16,18-pentaen-13-ylidene]amino]oxyacetate |
|---|---|
| PubChem CID | 152888326 |
| Molecular Formula | C21H22ClNO8 |
| Molecular Weight | 451.86 g/mol |
| Exact Mass | 451.10 |
| IUPAC Name | methyl 2-[[(4R,6R,8R,9Z,11E)-16-chloro-17,19-dihydroxy-4-methyl-2-oxo-3,7-dioxatricyclo[13.4.0.06,8]nonadeca-1(15),9,11,16,18-pentaen-13-ylidene]amino]oxyacetate |
| SMILES | COC(=O)CON=C1/C=C/C=C/[C@H]2O[C@@H]2C[C@@H](C)OC(=O)c2c(O)cc(O)c(Cl)c2C1 |
| InChI | InChI=1S/C21H22ClNO8/c1-11-7-17-16(31-17)6-4-3-5-12(23-29-10-18(26)28-2)8-13-19(21(27)30-11)14(24)9-15(25)20(13)22/h3-6,9,11,16-17,24-25H,7-8,10H2,1-2H3/b5-3+,6-4+,23-12?/t11-,16-,17-/m1/s1 |
| InChIKey | UCYDGVUGALYMDR-RNTMKQPQSA-N |
| XLogP | 2.67 |
| TPSA | 127.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.86 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|