About methyl 2-acetamidopent-4-enoate
methyl 2-acetamidopent-4-enoate (PubChem CID 15289013) has the molecular formula C8H13NO3
and a molecular weight of 171.20 g/mol. Its IUPAC name is methyl 2-acetamidopent-4-enoate.
Molecular Properties
| Compound Name | methyl 2-acetamidopent-4-enoate |
| PubChem CID | 15289013 |
| Molecular Formula | C8H13NO3 |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.09 |
| IUPAC Name | methyl 2-acetamidopent-4-enoate |
| SMILES | C=CCC(NC(C)=O)C(=O)OC |
| InChI | InChI=1S/C8H13NO3/c1-4-5-7(8(11)12-3)9-6(2)10/h4,7H,1,5H2,2-3H3,(H,9,10) |
| InChIKey | MIBMMKTXTRJVOP-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-acetamidopent-4-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-acetamidopent-4-enoate?
The IUPAC name of methyl 2-acetamidopent-4-enoate (CID 15289013) is methyl 2-acetamidopent-4-enoate.
What is the SMILES notation for methyl 2-acetamidopent-4-enoate?
The canonical SMILES for methyl 2-acetamidopent-4-enoate is C=CCC(NC(C)=O)C(=O)OC.
What is the InChIKey of methyl 2-acetamidopent-4-enoate?
The InChIKey is MIBMMKTXTRJVOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NO3/c1-4-5-7(8(11)12-3)9-6(2)10/h4,7H,1,5H2,2-3H3,(H,9,10).
What are the key properties of methyl 2-acetamidopent-4-enoate?
methyl 2-acetamidopent-4-enoate has a molecular weight of 171.20 g/mol, XLogP of 0.24, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-acetamidopent-4-enoate is sourced from PubChem (CID 15289013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).