C11H20FNOS — CID 152890764
(2R)-N-ethyl-2-fluoro-3-[(2E,4Z)-hexa-2,4-dien-3-yl]sulfinylpropan-1-amine (PubChem CID 152890764) has the molecular formula C11H20FNOS and a molecular weight of 233.35 g/mol. Its IUPAC name is (2R)-N-ethyl-2-fluoro-3-[(2E,4Z)-hexa-2,4-dien-3-yl]sulfinylpropan-1-amine.
| Compound Name | (2R)-N-ethyl-2-fluoro-3-[(2E,4Z)-hexa-2,4-dien-3-yl]sulfinylpropan-1-amine |
|---|---|
| PubChem CID | 152890764 |
| Molecular Formula | C11H20FNOS |
| Molecular Weight | 233.35 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | (2R)-N-ethyl-2-fluoro-3-[(2E,4Z)-hexa-2,4-dien-3-yl]sulfinylpropan-1-amine |
| SMILES | C/C=C\C(=C/C)S(=O)C[C@H](F)CNCC |
| InChI | InChI=1S/C11H20FNOS/c1-4-7-11(5-2)15(14)9-10(12)8-13-6-3/h4-5,7,10,13H,6,8-9H2,1-3H3/b7-4-,11-5+/t10-,15?/m1/s1 |
| InChIKey | UDKDIJOXDUVYBF-URCJDCBQSA-N |
| XLogP | 2.16 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.35 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|