C24H36FN3O10 — CID 15289211
[(2R,3R,4R,5R)-2-[4-(butoxycarbonylamino)-5-fluoro-2-oxopyrimidin-1-yl]-4-butoxycarbonyloxy-5-methyloxolan-3-yl] butyl carbonate (PubChem CID 15289211) has the molecular formula C24H36FN3O10 and a molecular weight of 545.56 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-2-[4-(butoxycarbonylamino)-5-fluoro-2-oxopyrimidin-1-yl]-4-butoxycarbonyloxy-5-methyloxolan-3-yl] butyl carbonate.
| Compound Name | [(2R,3R,4R,5R)-2-[4-(butoxycarbonylamino)-5-fluoro-2-oxopyrimidin-1-yl]-4-butoxycarbonyloxy-5-methyloxolan-3-yl] butyl carbonate |
|---|---|
| PubChem CID | 15289211 |
| Molecular Formula | C24H36FN3O10 |
| Molecular Weight | 545.56 g/mol |
| Exact Mass | 545.24 |
| IUPAC Name | [(2R,3R,4R,5R)-2-[4-(butoxycarbonylamino)-5-fluoro-2-oxopyrimidin-1-yl]-4-butoxycarbonyloxy-5-methyloxolan-3-yl] butyl carbonate |
| SMILES | CCCCOC(=O)Nc1nc(=O)n([C@@H]2O[C@H](C)[C@@H](OC(=O)OCCCC)[C@H]2OC(=O)OCCCC)cc1F |
| InChI | InChI=1S/C24H36FN3O10/c1-5-8-11-33-22(30)27-19-16(25)14-28(21(29)26-19)20-18(38-24(32)35-13-10-7-3)17(15(4)36-20)37-23(31)34-12-9-6-2/h14-15,17-18,20H,5-13H2,1-4H3,(H,26,27,29,30)/t15-,17-,18-,20-/m1/s1 |
| InChIKey | APGCYCKWUGARQM-DLVXIWMQSA-N |
| XLogP | 4.29 |
| TPSA | 153.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.56 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|