C26H27NO — CID 15289539
(3aS,4S,7aS)-4,7,7-triphenyl-2,3,3a,5,6,7a-hexahydro-1H-isoindol-4-ol (PubChem CID 15289539) has the molecular formula C26H27NO and a molecular weight of 369.51 g/mol. Its IUPAC name is (3aS,4S,7aS)-4,7,7-triphenyl-2,3,3a,5,6,7a-hexahydro-1H-isoindol-4-ol.
| Compound Name | (3aS,4S,7aS)-4,7,7-triphenyl-2,3,3a,5,6,7a-hexahydro-1H-isoindol-4-ol |
|---|---|
| PubChem CID | 15289539 |
| Molecular Formula | C26H27NO |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.21 |
| IUPAC Name | (3aS,4S,7aS)-4,7,7-triphenyl-2,3,3a,5,6,7a-hexahydro-1H-isoindol-4-ol |
| SMILES | O[C@@]1(c2ccccc2)CCC(c2ccccc2)(c2ccccc2)[C@H]2CNC[C@H]21 |
| InChI | InChI=1S/C26H27NO/c28-26(22-14-8-3-9-15-22)17-16-25(20-10-4-1-5-11-20,21-12-6-2-7-13-21)23-18-27-19-24(23)26/h1-15,23-24,27-28H,16-19H2/t23-,24+,26+/m0/s1 |
| InChIKey | CAUFDQZIJDJBEC-BFLUCZKCSA-N |
| XLogP | 4.49 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |