About 4-(cyclohexen-1-yl)-2,6-bis(trifluoromethyl)morpholine
4-(cyclohexen-1-yl)-2,6-bis(trifluoromethyl)morpholine (PubChem CID 152896447) has the molecular formula C12H15F6NO
and a molecular weight of 303.25 g/mol. Its IUPAC name is 4-(cyclohexen-1-yl)-2,6-bis(trifluoromethyl)morpholine.
Molecular Properties
| Compound Name | 4-(cyclohexen-1-yl)-2,6-bis(trifluoromethyl)morpholine |
| PubChem CID | 152896447 |
| Molecular Formula | C12H15F6NO |
| Molecular Weight | 303.25 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | 4-(cyclohexen-1-yl)-2,6-bis(trifluoromethyl)morpholine |
| SMILES | FC(F)(F)C1CN(C2=CCCCC2)CC(C(F)(F)F)O1 |
| InChI | InChI=1S/C12H15F6NO/c13-11(14,15)9-6-19(8-4-2-1-3-5-8)7-10(20-9)12(16,17)18/h4,9-10H,1-3,5-7H2 |
| InChIKey | UEMBQAXZJJGGMN-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.25 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(cyclohexen-1-yl)-2,6-bis(trifluoromethyl)morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(cyclohexen-1-yl)-2,6-bis(trifluoromethyl)morpholine?
The IUPAC name of 4-(cyclohexen-1-yl)-2,6-bis(trifluoromethyl)morpholine (CID 152896447) is 4-(cyclohexen-1-yl)-2,6-bis(trifluoromethyl)morpholine.
What is the SMILES notation for 4-(cyclohexen-1-yl)-2,6-bis(trifluoromethyl)morpholine?
The canonical SMILES for 4-(cyclohexen-1-yl)-2,6-bis(trifluoromethyl)morpholine is FC(F)(F)C1CN(C2=CCCCC2)CC(C(F)(F)F)O1.
What is the InChIKey of 4-(cyclohexen-1-yl)-2,6-bis(trifluoromethyl)morpholine?
The InChIKey is UEMBQAXZJJGGMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15F6NO/c13-11(14,15)9-6-19(8-4-2-1-3-5-8)7-10(20-9)12(16,17)18/h4,9-10H,1-3,5-7H2.
What are the key properties of 4-(cyclohexen-1-yl)-2,6-bis(trifluoromethyl)morpholine?
4-(cyclohexen-1-yl)-2,6-bis(trifluoromethyl)morpholine has a molecular weight of 303.25 g/mol, XLogP of 3.64, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(cyclohexen-1-yl)-2,6-bis(trifluoromethyl)morpholine is sourced from PubChem (CID 152896447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).