About diethyl 5-amino-2-fluoro-6-phenylpyridine-3,4-dicarboxylate
diethyl 5-amino-2-fluoro-6-phenylpyridine-3,4-dicarboxylate (PubChem CID 15289698) has the molecular formula C17H17FN2O4
and a molecular weight of 332.33 g/mol. Its IUPAC name is diethyl 5-amino-2-fluoro-6-phenylpyridine-3,4-dicarboxylate.
Molecular Properties
| Compound Name | diethyl 5-amino-2-fluoro-6-phenylpyridine-3,4-dicarboxylate |
| PubChem CID | 15289698 |
| Molecular Formula | C17H17FN2O4 |
| Molecular Weight | 332.33 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | diethyl 5-amino-2-fluoro-6-phenylpyridine-3,4-dicarboxylate |
| SMILES | CCOC(=O)c1c(F)nc(-c2ccccc2)c(N)c1C(=O)OCC |
| InChI | InChI=1S/C17H17FN2O4/c1-3-23-16(21)11-12(17(22)24-4-2)15(18)20-14(13(11)19)10-8-6-5-7-9-10/h5-9H,3-4,19H2,1-2H3 |
| InChIKey | BVRWRRZABJOJDS-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 91.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.33 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze diethyl 5-amino-2-fluoro-6-phenylpyridine-3,4-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl 5-amino-2-fluoro-6-phenylpyridine-3,4-dicarboxylate?
The IUPAC name of diethyl 5-amino-2-fluoro-6-phenylpyridine-3,4-dicarboxylate (CID 15289698) is diethyl 5-amino-2-fluoro-6-phenylpyridine-3,4-dicarboxylate.
What is the SMILES notation for diethyl 5-amino-2-fluoro-6-phenylpyridine-3,4-dicarboxylate?
The canonical SMILES for diethyl 5-amino-2-fluoro-6-phenylpyridine-3,4-dicarboxylate is CCOC(=O)c1c(F)nc(-c2ccccc2)c(N)c1C(=O)OCC.
What is the InChIKey of diethyl 5-amino-2-fluoro-6-phenylpyridine-3,4-dicarboxylate?
The InChIKey is BVRWRRZABJOJDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17FN2O4/c1-3-23-16(21)11-12(17(22)24-4-2)15(18)20-14(13(11)19)10-8-6-5-7-9-10/h5-9H,3-4,19H2,1-2H3.
What are the key properties of diethyl 5-amino-2-fluoro-6-phenylpyridine-3,4-dicarboxylate?
diethyl 5-amino-2-fluoro-6-phenylpyridine-3,4-dicarboxylate has a molecular weight of 332.33 g/mol, XLogP of 2.82, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl 5-amino-2-fluoro-6-phenylpyridine-3,4-dicarboxylate is sourced from PubChem (CID 15289698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).