C34H34F3N5O2S — CID 152897091
N-[4-methyl-3-(5-methyl-2-propan-2-ylphenyl)-1,3-thiazol-2-ylidene]-5-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]pentanamide (PubChem CID 152897091) has the molecular formula C34H34F3N5O2S and a molecular weight of 633.74 g/mol. Its IUPAC name is N-[4-methyl-3-(5-methyl-2-propan-2-ylphenyl)-1,3-thiazol-2-ylidene]-5-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]pentanamide.
| Compound Name | N-[4-methyl-3-(5-methyl-2-propan-2-ylphenyl)-1,3-thiazol-2-ylidene]-5-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]pentanamide |
|---|---|
| PubChem CID | 152897091 |
| Molecular Formula | C34H34F3N5O2S |
| Molecular Weight | 633.74 g/mol |
| Exact Mass | 633.24 |
| IUPAC Name | N-[4-methyl-3-(5-methyl-2-propan-2-ylphenyl)-1,3-thiazol-2-ylidene]-5-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]pentanamide |
| SMILES | Cc1ccc(C(C)C)c(-n2c(C)cs/c2=N\C(=O)CCCCc2ccc(-c3ncn(-c4ccc(OC(F)(F)F)cc4)n3)cc2)c1 |
| InChI | InChI=1S/C34H34F3N5O2S/c1-22(2)29-18-9-23(3)19-30(29)42-24(4)20-45-33(42)39-31(43)8-6-5-7-25-10-12-26(13-11-25)32-38-21-41(40-32)27-14-16-28(17-15-27)44-34(35,36)37/h9-22H,5-8H2,1-4H3/b39-33- |
| InChIKey | UEPFSMSYUFFNON-SCURRHDHSA-N |
| XLogP | 8.27 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.74 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|