C21H42N6O3 — CID 15289721
1,3,5-tris[2-(diethylamino)ethyl]-1,3,5-triazinane-2,4,6-trione (PubChem CID 15289721) has the molecular formula C21H42N6O3 and a molecular weight of 426.61 g/mol. Its IUPAC name is 1,3,5-tris[2-(diethylamino)ethyl]-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1,3,5-tris[2-(diethylamino)ethyl]-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 15289721 |
| Molecular Formula | C21H42N6O3 |
| Molecular Weight | 426.61 g/mol |
| Exact Mass | 426.33 |
| IUPAC Name | 1,3,5-tris[2-(diethylamino)ethyl]-1,3,5-triazinane-2,4,6-trione |
| SMILES | CCN(CC)CCn1c(=O)n(CCN(CC)CC)c(=O)n(CCN(CC)CC)c1=O |
| InChI | InChI=1S/C21H42N6O3/c1-7-22(8-2)13-16-25-19(28)26(17-14-23(9-3)10-4)21(30)27(20(25)29)18-15-24(11-5)12-6/h7-18H2,1-6H3 |
| InChIKey | AYXWJORHBWNBSC-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 75.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.61 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |