C21H34O — CID 15289749
trans-(1S,2S)-2-[(3,5-ditert-butylphenyl)methyl]cyclohexan-1-ol (PubChem CID 15289749) has the molecular formula C21H34O and a molecular weight of 302.50 g/mol. Its IUPAC name is trans-(1S,2S)-2-[(3,5-ditert-butylphenyl)methyl]cyclohexan-1-ol.
| Compound Name | trans-(1S,2S)-2-[(3,5-ditert-butylphenyl)methyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 15289749 |
| Molecular Formula | C21H34O |
| Molecular Weight | 302.50 g/mol |
| Exact Mass | 302.26 |
| IUPAC Name | trans-(1S,2S)-2-[(3,5-ditert-butylphenyl)methyl]cyclohexan-1-ol |
| SMILES | CC(C)(C)c1cc(C[C@@H]2CCCC[C@@H]2O)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C21H34O/c1-20(2,3)17-12-15(13-18(14-17)21(4,5)6)11-16-9-7-8-10-19(16)22/h12-14,16,19,22H,7-11H2,1-6H3/t16-,19-/m0/s1 |
| InChIKey | BFOJTQBQQILUOC-LPHOPBHVSA-N |
| XLogP | 5.38 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.50 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |