C29H33FN8O — CID 152897502
1-(6-fluoro-2-pyridinyl)-6-[4-(9-methyl-3,9-diazaspiro[5.5]undecan-3-yl)anilino]-2-prop-2-enylpyrazolo[3,4-d]pyrimidin-3-one (PubChem CID 152897502) has the molecular formula C29H33FN8O and a molecular weight of 528.64 g/mol. Its IUPAC name is 1-(6-fluoro-2-pyridinyl)-6-[4-(9-methyl-3,9-diazaspiro[5.5]undecan-3-yl)anilino]-2-prop-2-enylpyrazolo[3,4-d]pyrimidin-3-one.
| Compound Name | 1-(6-fluoro-2-pyridinyl)-6-[4-(9-methyl-3,9-diazaspiro[5.5]undecan-3-yl)anilino]-2-prop-2-enylpyrazolo[3,4-d]pyrimidin-3-one |
|---|---|
| PubChem CID | 152897502 |
| Molecular Formula | C29H33FN8O |
| Molecular Weight | 528.64 g/mol |
| Exact Mass | 528.28 |
| IUPAC Name | 1-(6-fluoro-2-pyridinyl)-6-[4-(9-methyl-3,9-diazaspiro[5.5]undecan-3-yl)anilino]-2-prop-2-enylpyrazolo[3,4-d]pyrimidin-3-one |
| SMILES | C=CCn1c(=O)c2cnc(Nc3ccc(N4CCC5(CCN(C)CC5)CC4)cc3)nc2n1-c1cccc(F)n1 |
| InChI | InChI=1S/C29H33FN8O/c1-3-15-37-27(39)23-20-31-28(34-26(23)38(37)25-6-4-5-24(30)33-25)32-21-7-9-22(10-8-21)36-18-13-29(14-19-36)11-16-35(2)17-12-29/h3-10,20H,1,11-19H2,2H3,(H,31,32,34) |
| InChIKey | UERFLNFAZFJPKN-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 84.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.64 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|