C16H25N5O — CID 15289761
6,6-dimethyl-1-(4-pentoxyphenyl)-1,3,5-triazine-2,4-diamine (PubChem CID 15289761) has the molecular formula C16H25N5O and a molecular weight of 303.41 g/mol. Its IUPAC name is 6,6-dimethyl-1-(4-pentoxyphenyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6,6-dimethyl-1-(4-pentoxyphenyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 15289761 |
| Molecular Formula | C16H25N5O |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.21 |
| IUPAC Name | 6,6-dimethyl-1-(4-pentoxyphenyl)-1,3,5-triazine-2,4-diamine |
| SMILES | CCCCCOc1ccc(N2C(N)=NC(N)=NC2(C)C)cc1 |
| InChI | InChI=1S/C16H25N5O/c1-4-5-6-11-22-13-9-7-12(8-10-13)21-15(18)19-14(17)20-16(21,2)3/h7-10H,4-6,11H2,1-3H3,(H4,17,18,19,20) |
| InChIKey | JKTCZPCDEUBDBJ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 89.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|