C15H15F2N3OS — CID 15290001
N-[[3-[(2S)-5,7-difluoro-1,2,3,4-tetrahydronaphthalen-2-yl]-2-sulfanylidene-1H-imidazol-4-yl]methyl]formamide (PubChem CID 15290001) has the molecular formula C15H15F2N3OS and a molecular weight of 323.37 g/mol. Its IUPAC name is N-[[3-[(2S)-5,7-difluoro-1,2,3,4-tetrahydronaphthalen-2-yl]-2-sulfanylidene-1H-imidazol-4-yl]methyl]formamide.
| Compound Name | N-[[3-[(2S)-5,7-difluoro-1,2,3,4-tetrahydronaphthalen-2-yl]-2-sulfanylidene-1H-imidazol-4-yl]methyl]formamide |
|---|---|
| PubChem CID | 15290001 |
| Molecular Formula | C15H15F2N3OS |
| Molecular Weight | 323.37 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | N-[[3-[(2S)-5,7-difluoro-1,2,3,4-tetrahydronaphthalen-2-yl]-2-sulfanylidene-1H-imidazol-4-yl]methyl]formamide |
| SMILES | O=CNCc1c[nH]c(=S)n1[C@H]1CCc2c(F)cc(F)cc2C1 |
| InChI | InChI=1S/C15H15F2N3OS/c16-10-3-9-4-11(1-2-13(9)14(17)5-10)20-12(6-18-8-21)7-19-15(20)22/h3,5,7-8,11H,1-2,4,6H2,(H,18,21)(H,19,22)/t11-/m0/s1 |
| InChIKey | VCWZTZJOSXAJFF-NSHDSACASA-N |
| XLogP | 2.80 |
| TPSA | 49.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.37 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|