C27H28N2O4 — CID 15290511
2-[[6-[(2E)-2-[phenyl(pyridin-4-yl)methoxy]iminopropyl]-5,6,7,8-tetrahydronaphthalen-1-yl]oxy]acetic acid (PubChem CID 15290511) has the molecular formula C27H28N2O4 and a molecular weight of 444.53 g/mol. Its IUPAC name is 2-[[6-[(2E)-2-[phenyl(pyridin-4-yl)methoxy]iminopropyl]-5,6,7,8-tetrahydronaphthalen-1-yl]oxy]acetic acid.
| Compound Name | 2-[[6-[(2E)-2-[phenyl(pyridin-4-yl)methoxy]iminopropyl]-5,6,7,8-tetrahydronaphthalen-1-yl]oxy]acetic acid |
|---|---|
| PubChem CID | 15290511 |
| Molecular Formula | C27H28N2O4 |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | 2-[[6-[(2E)-2-[phenyl(pyridin-4-yl)methoxy]iminopropyl]-5,6,7,8-tetrahydronaphthalen-1-yl]oxy]acetic acid |
| SMILES | C/C(CC1CCc2c(cccc2OCC(=O)O)C1)=N\OC(c1ccccc1)c1ccncc1 |
| InChI | InChI=1S/C27H28N2O4/c1-19(29-33-27(21-6-3-2-4-7-21)22-12-14-28-15-13-22)16-20-10-11-24-23(17-20)8-5-9-25(24)32-18-26(30)31/h2-9,12-15,20,27H,10-11,16-18H2,1H3,(H,30,31)/b29-19+ |
| InChIKey | NXAGVGKQFQTDAH-VUTHCHCSSA-N |
| XLogP | 5.22 |
| TPSA | 81.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|