About CID 152907285
CID 152907285 (PubChem CID 152907285) has the molecular formula C23H35B3N10O3
and a molecular weight of 532.04 g/mol.
Molecular Properties
| Compound Name | CID 152907285 |
| PubChem CID | 152907285 |
| Molecular Formula | C23H35B3N10O3 |
| Molecular Weight | 532.04 g/mol |
| Exact Mass | 532.32 |
| IUPAC Name | — |
| SMILES | [B]Cc1cn(CC(Cn2cc(C[B])nn2)(Cn2cc(C[B])nn2)NC(=O)COCCCOCC(C)CC)nn1 |
| InChI | InChI=1S/C23H35B3N10O3/c1-3-18(2)13-38-5-4-6-39-14-22(37)27-23(15-34-10-19(7-24)28-31-34,16-35-11-20(8-25)29-32-35)17-36-12-21(9-26)30-33-36/h10-12,18H,3-9,13-17H2,1-2H3,(H,27,37) |
| InChIKey | MRZXTVNOLCZNRI-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 139.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 532.04 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 152907285 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 152907285?
The IUPAC name of CID 152907285 (CID 152907285) is not available.
What is the SMILES notation for CID 152907285?
The canonical SMILES for CID 152907285 is [B]Cc1cn(CC(Cn2cc(C[B])nn2)(Cn2cc(C[B])nn2)NC(=O)COCCCOCC(C)CC)nn1.
What is the InChIKey of CID 152907285?
The InChIKey is MRZXTVNOLCZNRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H35B3N10O3/c1-3-18(2)13-38-5-4-6-39-14-22(37)27-23(15-34-10-19(7-24)28-31-34,16-35-11-20(8-25)29-32-35)17-36-12-21(9-26)30-33-36/h10-12,18H,3-9,13-17H2,1-2H3,(H,27,37).
What are the key properties of CID 152907285?
CID 152907285 has a molecular weight of 532.04 g/mol, XLogP of -0.81, 19 rotatable bonds, 1 hydrogen bond donors, and 12 hydrogen bond acceptors.
Where does this data come from?
All data for CID 152907285 is sourced from PubChem (CID 152907285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).