About 4a,8a-dihydro-1,5-naphthyridine
4a,8a-dihydro-1,5-naphthyridine (PubChem CID 152908208) has the molecular formula C8H8N2
and a molecular weight of 132.17 g/mol. Its IUPAC name is 4a,8a-dihydro-1,5-naphthyridine.
Molecular Properties
| Compound Name | 4a,8a-dihydro-1,5-naphthyridine |
| PubChem CID | 152908208 |
| Molecular Formula | C8H8N2 |
| Molecular Weight | 132.17 g/mol |
| Exact Mass | 132.07 |
| IUPAC Name | 4a,8a-dihydro-1,5-naphthyridine |
| SMILES | C1=CC2N=CC=CC2N=C1 |
| InChI | InChI=1S/C8H8N2/c1-3-7-8(9-5-1)4-2-6-10-7/h1-8H |
| InChIKey | UGRBVGMCIACODJ-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.17 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4a,8a-dihydro-1,5-naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4a,8a-dihydro-1,5-naphthyridine?
The IUPAC name of 4a,8a-dihydro-1,5-naphthyridine (CID 152908208) is 4a,8a-dihydro-1,5-naphthyridine.
What is the SMILES notation for 4a,8a-dihydro-1,5-naphthyridine?
The canonical SMILES for 4a,8a-dihydro-1,5-naphthyridine is C1=CC2N=CC=CC2N=C1.
What is the InChIKey of 4a,8a-dihydro-1,5-naphthyridine?
The InChIKey is UGRBVGMCIACODJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2/c1-3-7-8(9-5-1)4-2-6-10-7/h1-8H.
What are the key properties of 4a,8a-dihydro-1,5-naphthyridine?
4a,8a-dihydro-1,5-naphthyridine has a molecular weight of 132.17 g/mol, XLogP of 1.00, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4a,8a-dihydro-1,5-naphthyridine is sourced from PubChem (CID 152908208), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).