C23H21F2N3O4 — CID 152908998
4-[4-[[3-[(E)-2-(2,4-difluorophenyl)ethenyl]-2-hydroxyphenyl]iminomethyl]-5-methyl-3-oxo-1H-pyrazol-2-yl]butanoic acid (PubChem CID 152908998) has the molecular formula C23H21F2N3O4 and a molecular weight of 441.43 g/mol. Its IUPAC name is 4-[4-[[3-[(E)-2-(2,4-difluorophenyl)ethenyl]-2-hydroxyphenyl]iminomethyl]-5-methyl-3-oxo-1H-pyrazol-2-yl]butanoic acid.
| Compound Name | 4-[4-[[3-[(E)-2-(2,4-difluorophenyl)ethenyl]-2-hydroxyphenyl]iminomethyl]-5-methyl-3-oxo-1H-pyrazol-2-yl]butanoic acid |
|---|---|
| PubChem CID | 152908998 |
| Molecular Formula | C23H21F2N3O4 |
| Molecular Weight | 441.43 g/mol |
| Exact Mass | 441.15 |
| IUPAC Name | 4-[4-[[3-[(E)-2-(2,4-difluorophenyl)ethenyl]-2-hydroxyphenyl]iminomethyl]-5-methyl-3-oxo-1H-pyrazol-2-yl]butanoic acid |
| SMILES | Cc1[nH]n(CCCC(=O)O)c(=O)c1/C=N/c1cccc(/C=C/c2ccc(F)cc2F)c1O |
| InChI | InChI=1S/C23H21F2N3O4/c1-14-18(23(32)28(27-14)11-3-6-21(29)30)13-26-20-5-2-4-16(22(20)31)8-7-15-9-10-17(24)12-19(15)25/h2,4-5,7-10,12-13,27,31H,3,6,11H2,1H3,(H,29,30)/b8-7+,26-13+ |
| InChIKey | VVPNNNRXWHABRW-ZCKAXEINSA-N |
| XLogP | 4.25 |
| TPSA | 107.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.43 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_phenol_A(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|