C31H32BFN3O2+ — CID 152909545
[5-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolane-2-carboximidoyl)-2-pyridinyl]-tritylazanium (PubChem CID 152909545) has the molecular formula C31H32BFN3O2+ and a molecular weight of 508.43 g/mol. Its IUPAC name is [5-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolane-2-carboximidoyl)-2-pyridinyl]-tritylazanium.
| Compound Name | [5-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolane-2-carboximidoyl)-2-pyridinyl]-tritylazanium |
|---|---|
| PubChem CID | 152909545 |
| Molecular Formula | C31H32BFN3O2+ |
| Molecular Weight | 508.43 g/mol |
| Exact Mass | 508.26 |
| IUPAC Name | [5-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolane-2-carboximidoyl)-2-pyridinyl]-tritylazanium |
| SMILES | [H]/N=C(/B1OC(C)(C)C(C)(C)O1)c1cc(F)cnc1[NH2+]C(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H31BFN3O2/c1-29(2)30(3,4)38-32(37-29)27(34)26-20-25(33)21-35-28(26)36-31(22-14-8-5-9-15-22,23-16-10-6-11-17-23)24-18-12-7-13-19-24/h5-21,34H,1-4H3,(H,35,36)/p+1/b34-27+ |
| InChIKey | UGXQCFKTMAMWSG-DNGXXSEMSA-O |
| XLogP | 5.41 |
| TPSA | 71.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.43 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|