About 3,5-ditert-butyl-6-iminocyclohexa-2,4-dien-1-one
3,5-ditert-butyl-6-iminocyclohexa-2,4-dien-1-one (PubChem CID 15291331) has the molecular formula C14H21NO
and a molecular weight of 219.33 g/mol. Its IUPAC name is 3,5-ditert-butyl-6-iminocyclohexa-2,4-dien-1-one.
Molecular Properties
| Compound Name | 3,5-ditert-butyl-6-iminocyclohexa-2,4-dien-1-one |
| PubChem CID | 15291331 |
| Molecular Formula | C14H21NO |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.16 |
| IUPAC Name | 3,5-ditert-butyl-6-iminocyclohexa-2,4-dien-1-one |
| SMILES | [H]/N=C1\C(=O)C=C(C(C)(C)C)C=C1C(C)(C)C |
| InChI | InChI=1S/C14H21NO/c1-13(2,3)9-7-10(14(4,5)6)12(15)11(16)8-9/h7-8,15H,1-6H3/b15-12- |
| InChIKey | FMQSIFGQRUNHIU-QINSGFPZSA-N |
| XLogP | 3.53 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3,5-ditert-butyl-6-iminocyclohexa-2,4-dien-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-ditert-butyl-6-iminocyclohexa-2,4-dien-1-one?
The IUPAC name of 3,5-ditert-butyl-6-iminocyclohexa-2,4-dien-1-one (CID 15291331) is 3,5-ditert-butyl-6-iminocyclohexa-2,4-dien-1-one.
What is the SMILES notation for 3,5-ditert-butyl-6-iminocyclohexa-2,4-dien-1-one?
The canonical SMILES for 3,5-ditert-butyl-6-iminocyclohexa-2,4-dien-1-one is [H]/N=C1\C(=O)C=C(C(C)(C)C)C=C1C(C)(C)C.
What is the InChIKey of 3,5-ditert-butyl-6-iminocyclohexa-2,4-dien-1-one?
The InChIKey is FMQSIFGQRUNHIU-QINSGFPZSA-N. The full InChI is InChI=1S/C14H21NO/c1-13(2,3)9-7-10(14(4,5)6)12(15)11(16)8-9/h7-8,15H,1-6H3/b15-12-.
What are the key properties of 3,5-ditert-butyl-6-iminocyclohexa-2,4-dien-1-one?
3,5-ditert-butyl-6-iminocyclohexa-2,4-dien-1-one has a molecular weight of 219.33 g/mol, XLogP of 3.53, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-ditert-butyl-6-iminocyclohexa-2,4-dien-1-one is sourced from PubChem (CID 15291331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).