C15H13N3O — CID 15291364
16,16-dimethyl-2,5,8-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,10,12,14-hexaen-7-one (PubChem CID 15291364) has the molecular formula C15H13N3O and a molecular weight of 251.29 g/mol. Its IUPAC name is 16,16-dimethyl-2,5,8-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,10,12,14-hexaen-7-one.
| Compound Name | 16,16-dimethyl-2,5,8-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,10,12,14-hexaen-7-one |
|---|---|
| PubChem CID | 15291364 |
| Molecular Formula | C15H13N3O |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.11 |
| IUPAC Name | 16,16-dimethyl-2,5,8-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,10,12,14-hexaen-7-one |
| SMILES | CC1(C)c2ccccc2-c2[nH]c(=O)c3nccn3c21 |
| InChI | InChI=1S/C15H13N3O/c1-15(2)10-6-4-3-5-9(10)11-12(15)18-8-7-16-13(18)14(19)17-11/h3-8H,1-2H3,(H,17,19) |
| InChIKey | XDPAKVHTDDSXSY-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |