C20H36O4 — CID 152914214
1-[(3S,4R)-3-[(2R,4S,5S)-6-ethyl-3,4,5-trimethyloxan-2-yl]oxy-4,5,6-trimethyloxan-2-yl]ethanone (PubChem CID 152914214) has the molecular formula C20H36O4 and a molecular weight of 340.50 g/mol. Its IUPAC name is 1-[(3S,4R)-3-[(2R,4S,5S)-6-ethyl-3,4,5-trimethyloxan-2-yl]oxy-4,5,6-trimethyloxan-2-yl]ethanone.
| Compound Name | 1-[(3S,4R)-3-[(2R,4S,5S)-6-ethyl-3,4,5-trimethyloxan-2-yl]oxy-4,5,6-trimethyloxan-2-yl]ethanone |
|---|---|
| PubChem CID | 152914214 |
| Molecular Formula | C20H36O4 |
| Molecular Weight | 340.50 g/mol |
| Exact Mass | 340.26 |
| IUPAC Name | 1-[(3S,4R)-3-[(2R,4S,5S)-6-ethyl-3,4,5-trimethyloxan-2-yl]oxy-4,5,6-trimethyloxan-2-yl]ethanone |
| SMILES | CCC1O[C@H](O[C@@H]2C(C(C)=O)OC(C)C(C)[C@H]2C)C(C)[C@@H](C)[C@@H]1C |
| InChI | InChI=1S/C20H36O4/c1-9-17-12(4)10(2)14(6)20(23-17)24-18-13(5)11(3)16(8)22-19(18)15(7)21/h10-14,16-20H,9H2,1-8H3/t10-,11?,12-,13+,14?,16?,17?,18-,19?,20+/m0/s1 |
| InChIKey | UHULKPILGVUGKI-DIHPNYCUSA-N |
| XLogP | 4.06 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.50 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |