C11H14N5O3S+ — CID 152916691
methyl 2-[4-(2-aminopyrimidin-4-yl)pyridazin-1-ium-1-yl]ethanesulfonate (PubChem CID 152916691) has the molecular formula C11H14N5O3S+ and a molecular weight of 296.33 g/mol. Its IUPAC name is methyl 2-[4-(2-aminopyrimidin-4-yl)pyridazin-1-ium-1-yl]ethanesulfonate.
| Compound Name | methyl 2-[4-(2-aminopyrimidin-4-yl)pyridazin-1-ium-1-yl]ethanesulfonate |
|---|---|
| PubChem CID | 152916691 |
| Molecular Formula | C11H14N5O3S+ |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | methyl 2-[4-(2-aminopyrimidin-4-yl)pyridazin-1-ium-1-yl]ethanesulfonate |
| SMILES | COS(=O)(=O)CC[n+]1ccc(-c2ccnc(N)n2)cn1 |
| InChI | InChI=1S/C11H14N5O3S/c1-19-20(17,18)7-6-16-5-3-9(8-14-16)10-2-4-13-11(12)15-10/h2-5,8H,6-7H2,1H3,(H2,12,13,15)/q+1 |
| InChIKey | UIGQCFSVJVSQRH-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 111.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|