C36H39Cl3N2O2 — CID 15292460
1-[3-[2-(4-benzylpyridin-1-ium-1-yl)ethyl]-3-(3,4-dichlorophenyl)piperidin-1-yl]-2-(3-propan-2-yloxyphenyl)ethanone chloride (PubChem CID 15292460) has the molecular formula C36H39Cl3N2O2 and a molecular weight of 638.08 g/mol. Its IUPAC name is 1-[3-[2-(4-benzylpyridin-1-ium-1-yl)ethyl]-3-(3,4-dichlorophenyl)piperidin-1-yl]-2-(3-propan-2-yloxyphenyl)ethanone chloride.
| Compound Name | 1-[3-[2-(4-benzylpyridin-1-ium-1-yl)ethyl]-3-(3,4-dichlorophenyl)piperidin-1-yl]-2-(3-propan-2-yloxyphenyl)ethanone chloride |
|---|---|
| PubChem CID | 15292460 |
| Molecular Formula | C36H39Cl3N2O2 |
| Molecular Weight | 638.08 g/mol |
| Exact Mass | 636.21 |
| IUPAC Name | 1-[3-[2-(4-benzylpyridin-1-ium-1-yl)ethyl]-3-(3,4-dichlorophenyl)piperidin-1-yl]-2-(3-propan-2-yloxyphenyl)ethanone chloride |
| SMILES | CC(C)Oc1cccc(CC(=O)N2CCCC(CC[n+]3ccc(Cc4ccccc4)cc3)(c3ccc(Cl)c(Cl)c3)C2)c1.[Cl-] |
| InChI | InChI=1S/C36H39Cl2N2O2.ClH/c1-27(2)42-32-11-6-10-30(23-32)24-35(41)40-18-7-16-36(26-40,31-12-13-33(37)34(38)25-31)17-21-39-19-14-29(15-20-39)22-28-8-4-3-5-9-28;/h3-6,8-15,19-20,23,25,27H,7,16-18,21-22,24,26H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | HFVWKXJGIOEUKV-UHFFFAOYSA-M |
| XLogP | 4.86 |
| TPSA | 33.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.08 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|