C10H10N2O2 — CID 15292474
3,3-dimethyl-1H-1,8-naphthyridine-2,4-dione (PubChem CID 15292474) has the molecular formula C10H10N2O2 and a molecular weight of 190.20 g/mol. Its IUPAC name is 3,3-dimethyl-1H-1,8-naphthyridine-2,4-dione.
| Compound Name | 3,3-dimethyl-1H-1,8-naphthyridine-2,4-dione |
|---|---|
| PubChem CID | 15292474 |
| Molecular Formula | C10H10N2O2 |
| Molecular Weight | 190.20 g/mol |
| Exact Mass | 190.07 |
| IUPAC Name | 3,3-dimethyl-1H-1,8-naphthyridine-2,4-dione |
| SMILES | CC1(C)C(=O)Nc2ncccc2C1=O |
| InChI | InChI=1S/C10H10N2O2/c1-10(2)7(13)6-4-3-5-11-8(6)12-9(10)14/h3-5H,1-2H3,(H,11,12,14) |
| InChIKey | PWLZLSHAOFRRDT-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.20 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|