About 2-amino-1,3-thiazolidin-4-one
2-amino-1,3-thiazolidin-4-one (PubChem CID 15292580) has the molecular formula C3H6N2OS
and a molecular weight of 118.16 g/mol. Its IUPAC name is 2-amino-1,3-thiazolidin-4-one.
Molecular Properties
| Compound Name | 2-amino-1,3-thiazolidin-4-one |
| PubChem CID | 15292580 |
| Molecular Formula | C3H6N2OS |
| Molecular Weight | 118.16 g/mol |
| Exact Mass | 118.02 |
| IUPAC Name | 2-amino-1,3-thiazolidin-4-one |
| SMILES | NC1NC(=O)CS1 |
| InChI | InChI=1S/C3H6N2OS/c4-3-5-2(6)1-7-3/h3H,1,4H2,(H,5,6) |
| InChIKey | LRIYFYUQOIQGQV-UHFFFAOYSA-N |
| XLogP | -0.91 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 118.16 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-amino-1,3-thiazolidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-1,3-thiazolidin-4-one?
The IUPAC name of 2-amino-1,3-thiazolidin-4-one (CID 15292580) is 2-amino-1,3-thiazolidin-4-one.
What is the SMILES notation for 2-amino-1,3-thiazolidin-4-one?
The canonical SMILES for 2-amino-1,3-thiazolidin-4-one is NC1NC(=O)CS1.
What is the InChIKey of 2-amino-1,3-thiazolidin-4-one?
The InChIKey is LRIYFYUQOIQGQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6N2OS/c4-3-5-2(6)1-7-3/h3H,1,4H2,(H,5,6).
What are the key properties of 2-amino-1,3-thiazolidin-4-one?
2-amino-1,3-thiazolidin-4-one has a molecular weight of 118.16 g/mol, XLogP of -0.91, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-1,3-thiazolidin-4-one is sourced from PubChem (CID 15292580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).